C13H25ClOSi — CID 134992589
[(2S,6S)-6-butan-2-yl-4-chloro-2-methyl-3,6-dihydro-2H-pyran-5-yl]-trimethylsilane (PubChem CID 134992589) has the molecular formula C13H25ClOSi and a molecular weight of 260.88 g/mol. Its IUPAC name is [(2S,6S)-6-butan-2-yl-4-chloro-2-methyl-3,6-dihydro-2H-pyran-5-yl]-trimethylsilane.
| Compound Name | [(2S,6S)-6-butan-2-yl-4-chloro-2-methyl-3,6-dihydro-2H-pyran-5-yl]-trimethylsilane |
|---|---|
| PubChem CID | 134992589 |
| Molecular Formula | C13H25ClOSi |
| Molecular Weight | 260.88 g/mol |
| Exact Mass | 260.14 |
| IUPAC Name | [(2S,6S)-6-butan-2-yl-4-chloro-2-methyl-3,6-dihydro-2H-pyran-5-yl]-trimethylsilane |
| SMILES | CCC(C)[C@@H]1O[C@@H](C)CC(Cl)=C1[Si](C)(C)C |
| InChI | InChI=1S/C13H25ClOSi/c1-7-9(2)12-13(16(4,5)6)11(14)8-10(3)15-12/h9-10,12H,7-8H2,1-6H3/t9?,10-,12-/m0/s1 |
| InChIKey | MCNXFAZXOKURMZ-CIZBPJNJSA-N |
| XLogP | 4.58 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.88 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|