C8H20OSi — CID 134992620
(2R,3R)-3-methyl-4-trimethylsilylbutan-2-ol (PubChem CID 134992620) has the molecular formula C8H20OSi and a molecular weight of 160.33 g/mol. Its IUPAC name is (2R,3R)-3-methyl-4-trimethylsilylbutan-2-ol.
| Compound Name | (2R,3R)-3-methyl-4-trimethylsilylbutan-2-ol |
|---|---|
| PubChem CID | 134992620 |
| Molecular Formula | C8H20OSi |
| Molecular Weight | 160.33 g/mol |
| Exact Mass | 160.13 |
| IUPAC Name | (2R,3R)-3-methyl-4-trimethylsilylbutan-2-ol |
| SMILES | C[C@@H](O)[C@@H](C)C[Si](C)(C)C |
| InChI | InChI=1S/C8H20OSi/c1-7(8(2)9)6-10(3,4)5/h7-9H,6H2,1-5H3/t7-,8+/m0/s1 |
| InChIKey | VHRMFGOAUHYCJQ-JGVFFNPUSA-N |
| XLogP | 2.34 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.33 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|