C8H18OSi — CID 11073706
(3R,4S)-1,1,4-trimethylsilinan-3-ol (PubChem CID 11073706) has the molecular formula C8H18OSi and a molecular weight of 158.32 g/mol. Its IUPAC name is (3R,4S)-1,1,4-trimethylsilinan-3-ol.
| Compound Name | (3R,4S)-1,1,4-trimethylsilinan-3-ol |
|---|---|
| PubChem CID | 11073706 |
| Molecular Formula | C8H18OSi |
| Molecular Weight | 158.32 g/mol |
| Exact Mass | 158.11 |
| IUPAC Name | (3R,4S)-1,1,4-trimethylsilinan-3-ol |
| SMILES | C[C@H]1CC[Si](C)(C)C[C@@H]1O |
| InChI | InChI=1S/C8H18OSi/c1-7-4-5-10(2,3)6-8(7)9/h7-9H,4-6H2,1-3H3/t7-,8-/m0/s1 |
| InChIKey | CSKOZOWPQSRTHH-YUMQZZPRSA-N |
| XLogP | 2.10 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.32 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|