C8H18OSi — CID 10080643
(1R)-1-[(1S,2R)-2-trimethylsilylcyclopropyl]ethanol (PubChem CID 10080643) has the molecular formula C8H18OSi and a molecular weight of 158.32 g/mol. Its IUPAC name is (1R)-1-[(1S,2R)-2-trimethylsilylcyclopropyl]ethanol.
| Compound Name | (1R)-1-[(1S,2R)-2-trimethylsilylcyclopropyl]ethanol |
|---|---|
| PubChem CID | 10080643 |
| Molecular Formula | C8H18OSi |
| Molecular Weight | 158.32 g/mol |
| Exact Mass | 158.11 |
| IUPAC Name | (1R)-1-[(1S,2R)-2-trimethylsilylcyclopropyl]ethanol |
| SMILES | C[C@@H](O)[C@@H]1C[C@H]1[Si](C)(C)C |
| InChI | InChI=1S/C8H18OSi/c1-6(9)7-5-8(7)10(2,3)4/h6-9H,5H2,1-4H3/t6-,7+,8-/m1/s1 |
| InChIKey | IYXFMEAJJXOVFI-GJMOJQLCSA-N |
| XLogP | 2.10 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.32 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|