C11H16BrNO3 — CID 134992842
(3S,8aS)-3-(2-bromopropan-2-yl)-3-methyl-6,7,8,8a-tetrahydropyrrolo[2,1-c][1,4]oxazine-1,4-dione (PubChem CID 134992842) has the molecular formula C11H16BrNO3 and a molecular weight of 290.16 g/mol. Its IUPAC name is (3S,8aS)-3-(2-bromopropan-2-yl)-3-methyl-6,7,8,8a-tetrahydropyrrolo[2,1-c][1,4]oxazine-1,4-dione.
| Compound Name | (3S,8aS)-3-(2-bromopropan-2-yl)-3-methyl-6,7,8,8a-tetrahydropyrrolo[2,1-c][1,4]oxazine-1,4-dione |
|---|---|
| PubChem CID | 134992842 |
| Molecular Formula | C11H16BrNO3 |
| Molecular Weight | 290.16 g/mol |
| Exact Mass | 289.03 |
| IUPAC Name | (3S,8aS)-3-(2-bromopropan-2-yl)-3-methyl-6,7,8,8a-tetrahydropyrrolo[2,1-c][1,4]oxazine-1,4-dione |
| SMILES | CC(C)(Br)[C@@]1(C)OC(=O)[C@@H]2CCCN2C1=O |
| InChI | InChI=1S/C11H16BrNO3/c1-10(2,12)11(3)9(15)13-6-4-5-7(13)8(14)16-11/h7H,4-6H2,1-3H3/t7-,11-/m0/s1 |
| InChIKey | YAOIDRPXAYTYCM-CPCISQLKSA-N |
| XLogP | 1.47 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.16 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|