C16H16N2O4 — CID 121248302
4-[[(3R,8aS)-3-methyl-1,4-dioxo-6,7,8,8a-tetrahydropyrrolo[2,1-c][1,4]oxazin-3-yl]methoxy]benzonitrile (PubChem CID 121248302) has the molecular formula C16H16N2O4 and a molecular weight of 300.31 g/mol. Its IUPAC name is 4-[[(3R,8aS)-3-methyl-1,4-dioxo-6,7,8,8a-tetrahydropyrrolo[2,1-c][1,4]oxazin-3-yl]methoxy]benzonitrile.
| Compound Name | 4-[[(3R,8aS)-3-methyl-1,4-dioxo-6,7,8,8a-tetrahydropyrrolo[2,1-c][1,4]oxazin-3-yl]methoxy]benzonitrile |
|---|---|
| PubChem CID | 121248302 |
| Molecular Formula | C16H16N2O4 |
| Molecular Weight | 300.31 g/mol |
| Exact Mass | 300.11 |
| IUPAC Name | 4-[[(3R,8aS)-3-methyl-1,4-dioxo-6,7,8,8a-tetrahydropyrrolo[2,1-c][1,4]oxazin-3-yl]methoxy]benzonitrile |
| SMILES | C[C@]1(COc2ccc(C#N)cc2)OC(=O)[C@@H]2CCCN2C1=O |
| InChI | InChI=1S/C16H16N2O4/c1-16(10-21-12-6-4-11(9-17)5-7-12)15(20)18-8-2-3-13(18)14(19)22-16/h4-7,13H,2-3,8,10H2,1H3/t13-,16+/m0/s1 |
| InChIKey | NQLMBZWGJYIPDI-XJKSGUPXSA-N |
| XLogP | 1.24 |
| TPSA | 79.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.31 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |