C10H18O4 — CID 134992961
(1R,2S)-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-methoxybut-3-en-1-ol (PubChem CID 134992961) has the molecular formula C10H18O4 and a molecular weight of 202.25 g/mol. Its IUPAC name is (1R,2S)-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-methoxybut-3-en-1-ol.
| Compound Name | (1R,2S)-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-methoxybut-3-en-1-ol |
|---|---|
| PubChem CID | 134992961 |
| Molecular Formula | C10H18O4 |
| Molecular Weight | 202.25 g/mol |
| Exact Mass | 202.12 |
| IUPAC Name | (1R,2S)-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-methoxybut-3-en-1-ol |
| SMILES | C=C[C@H](OC)[C@@H](O)[C@@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C10H18O4/c1-5-7(12-4)9(11)8-6-13-10(2,3)14-8/h5,7-9,11H,1,6H2,2-4H3/t7-,8-,9+/m0/s1 |
| InChIKey | ZHOVZKSSNCXFPU-XHNCKOQMSA-N |
| XLogP | 0.70 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.25 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|