C11H15ClO3 — CID 134993464
[(2E,4Z)-4-chloro-3,5-dimethyl-6-oxohepta-2,4-dienyl] acetate (PubChem CID 134993464) has the molecular formula C11H15ClO3 and a molecular weight of 230.69 g/mol. Its IUPAC name is [(2E,4Z)-4-chloro-3,5-dimethyl-6-oxohepta-2,4-dienyl] acetate.
| Compound Name | [(2E,4Z)-4-chloro-3,5-dimethyl-6-oxohepta-2,4-dienyl] acetate |
|---|---|
| PubChem CID | 134993464 |
| Molecular Formula | C11H15ClO3 |
| Molecular Weight | 230.69 g/mol |
| Exact Mass | 230.07 |
| IUPAC Name | [(2E,4Z)-4-chloro-3,5-dimethyl-6-oxohepta-2,4-dienyl] acetate |
| SMILES | CC(=O)OC/C=C(C)/C(Cl)=C(\C)C(C)=O |
| InChI | InChI=1S/C11H15ClO3/c1-7(5-6-15-10(4)14)11(12)8(2)9(3)13/h5H,6H2,1-4H3/b7-5+,11-8- |
| InChIKey | FICWCQDQCYLBLF-BFPPUAHJSA-N |
| XLogP | 2.60 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.69 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|