About ethyl 3-chlorobenzene-2-ide-1-carboxylate;manganese
ethyl 3-chlorobenzene-2-ide-1-carboxylate;manganese (PubChem CID 135042585) has the molecular formula C9H8ClMnO2-
and a molecular weight of 238.55 g/mol. Its IUPAC name is ethyl 3-chlorobenzene-2-ide-1-carboxylate;manganese.
Molecular Properties
| Compound Name | ethyl 3-chlorobenzene-2-ide-1-carboxylate;manganese |
| PubChem CID | 135042585 |
| Molecular Formula | C9H8ClMnO2- |
| Molecular Weight | 238.55 g/mol |
| Exact Mass | 237.96 |
| IUPAC Name | ethyl 3-chlorobenzene-2-ide-1-carboxylate;manganese |
| SMILES | CCOC(=O)c1[c-]c(Cl)ccc1.[Mn] |
| InChI | InChI=1S/C9H8ClO2.Mn/c1-2-12-9(11)7-4-3-5-8(10)6-7;/h3-5H,2H2,1H3;/q-1; |
| InChIKey | ZJIYTKUKBIHXFN-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.55 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze ethyl 3-chlorobenzene-2-ide-1-carboxylate;manganese with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 3-chlorobenzene-2-ide-1-carboxylate;manganese?
The IUPAC name of ethyl 3-chlorobenzene-2-ide-1-carboxylate;manganese (CID 135042585) is ethyl 3-chlorobenzene-2-ide-1-carboxylate;manganese.
What is the SMILES notation for ethyl 3-chlorobenzene-2-ide-1-carboxylate;manganese?
The canonical SMILES for ethyl 3-chlorobenzene-2-ide-1-carboxylate;manganese is CCOC(=O)c1[c-]c(Cl)ccc1.[Mn].
What is the InChIKey of ethyl 3-chlorobenzene-2-ide-1-carboxylate;manganese?
The InChIKey is ZJIYTKUKBIHXFN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8ClO2.Mn/c1-2-12-9(11)7-4-3-5-8(10)6-7;/h3-5H,2H2,1H3;/q-1;.
What are the key properties of ethyl 3-chlorobenzene-2-ide-1-carboxylate;manganese?
ethyl 3-chlorobenzene-2-ide-1-carboxylate;manganese has a molecular weight of 238.55 g/mol, XLogP of 2.31, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3-chlorobenzene-2-ide-1-carboxylate;manganese is sourced from PubChem (CID 135042585), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).