C24H18FN3O2 — CID 1349937
(2R,3R)-2-acetyl-4,4-dicyano-N-(4-fluorophenyl)-3-naphthalen-2-ylbutanamide (PubChem CID 1349937) has the molecular formula C24H18FN3O2 and a molecular weight of 399.43 g/mol. Its IUPAC name is (2R,3R)-2-acetyl-4,4-dicyano-N-(4-fluorophenyl)-3-naphthalen-2-ylbutanamide.
| Compound Name | (2R,3R)-2-acetyl-4,4-dicyano-N-(4-fluorophenyl)-3-naphthalen-2-ylbutanamide |
|---|---|
| PubChem CID | 1349937 |
| Molecular Formula | C24H18FN3O2 |
| Molecular Weight | 399.43 g/mol |
| Exact Mass | 399.14 |
| IUPAC Name | (2R,3R)-2-acetyl-4,4-dicyano-N-(4-fluorophenyl)-3-naphthalen-2-ylbutanamide |
| SMILES | CC(=O)[C@H](C(=O)Nc1ccc(F)cc1)C(c1ccc2ccccc2c1)C(C#N)C#N |
| InChI | InChI=1S/C24H18FN3O2/c1-15(29)22(24(30)28-21-10-8-20(25)9-11-21)23(19(13-26)14-27)18-7-6-16-4-2-3-5-17(16)12-18/h2-12,19,22-23H,1H3,(H,28,30)/t22-,23?/m0/s1 |
| InChIKey | VEFMLNOKHUKMLJ-NQCNTLBGSA-N |
| XLogP | 4.57 |
| TPSA | 93.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.43 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|