C22H20FN3O3 — CID 1349922
(2R,3R)-2-acetyl-4,4-dicyano-3-(4-ethoxyphenyl)-N-(4-fluorophenyl)butanamide (PubChem CID 1349922) has the molecular formula C22H20FN3O3 and a molecular weight of 393.42 g/mol. Its IUPAC name is (2R,3R)-2-acetyl-4,4-dicyano-3-(4-ethoxyphenyl)-N-(4-fluorophenyl)butanamide.
| Compound Name | (2R,3R)-2-acetyl-4,4-dicyano-3-(4-ethoxyphenyl)-N-(4-fluorophenyl)butanamide |
|---|---|
| PubChem CID | 1349922 |
| Molecular Formula | C22H20FN3O3 |
| Molecular Weight | 393.42 g/mol |
| Exact Mass | 393.15 |
| IUPAC Name | (2R,3R)-2-acetyl-4,4-dicyano-3-(4-ethoxyphenyl)-N-(4-fluorophenyl)butanamide |
| SMILES | CCOc1ccc([C@H](C(C#N)C#N)[C@H](C(C)=O)C(=O)Nc2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C22H20FN3O3/c1-3-29-19-10-4-15(5-11-19)21(16(12-24)13-25)20(14(2)27)22(28)26-18-8-6-17(23)7-9-18/h4-11,16,20-21H,3H2,1-2H3,(H,26,28)/t20-,21+/m0/s1 |
| InChIKey | JPWYSGZWDCTHSR-LEWJYISDSA-N |
| XLogP | 3.82 |
| TPSA | 102.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.42 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|