C11H14O5 — CID 134993917
dimethyl (3aS,6R,6aR)-3,3a,6,6a-tetrahydro-1H-cyclopenta[c]furan-4,6-dicarboxylate (PubChem CID 134993917) has the molecular formula C11H14O5 and a molecular weight of 226.23 g/mol. Its IUPAC name is dimethyl (3aS,6R,6aR)-3,3a,6,6a-tetrahydro-1H-cyclopenta[c]furan-4,6-dicarboxylate.
| Compound Name | dimethyl (3aS,6R,6aR)-3,3a,6,6a-tetrahydro-1H-cyclopenta[c]furan-4,6-dicarboxylate |
|---|---|
| PubChem CID | 134993917 |
| Molecular Formula | C11H14O5 |
| Molecular Weight | 226.23 g/mol |
| Exact Mass | 226.08 |
| IUPAC Name | dimethyl (3aS,6R,6aR)-3,3a,6,6a-tetrahydro-1H-cyclopenta[c]furan-4,6-dicarboxylate |
| SMILES | COC(=O)C1=C[C@@H](C(=O)OC)[C@@H]2COC[C@H]12 |
| InChI | InChI=1S/C11H14O5/c1-14-10(12)6-3-7(11(13)15-2)9-5-16-4-8(6)9/h3,6,8-9H,4-5H2,1-2H3/t6-,8+,9-/m1/s1 |
| InChIKey | HRNLBNZGDJPFLK-BWVDBABLSA-N |
| XLogP | 0.15 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.23 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |