C9H15NO2 — CID 134994239
methyl 3,6-dimethyl-3,6-dihydro-2H-pyridine-1-carboxylate (PubChem CID 134994239) has the molecular formula C9H15NO2 and a molecular weight of 169.22 g/mol. Its IUPAC name is methyl 3,6-dimethyl-3,6-dihydro-2H-pyridine-1-carboxylate.
| Compound Name | methyl 3,6-dimethyl-3,6-dihydro-2H-pyridine-1-carboxylate |
|---|---|
| PubChem CID | 134994239 |
| Molecular Formula | C9H15NO2 |
| Molecular Weight | 169.22 g/mol |
| Exact Mass | 169.11 |
| IUPAC Name | methyl 3,6-dimethyl-3,6-dihydro-2H-pyridine-1-carboxylate |
| SMILES | COC(=O)N1CC(C)C=CC1C |
| InChI | InChI=1S/C9H15NO2/c1-7-4-5-8(2)10(6-7)9(11)12-3/h4-5,7-8H,6H2,1-3H3 |
| InChIKey | CDSQLUWAQVAIBV-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.22 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|