C10H17N — CID 134994618
(2Z,4Z)-N,N-dimethylcycloocta-2,4-dien-1-amine (PubChem CID 134994618) has the molecular formula C10H17N and a molecular weight of 151.25 g/mol. Its IUPAC name is (2Z,4Z)-N,N-dimethylcycloocta-2,4-dien-1-amine.
| Compound Name | (2Z,4Z)-N,N-dimethylcycloocta-2,4-dien-1-amine |
|---|---|
| PubChem CID | 134994618 |
| Molecular Formula | C10H17N |
| Molecular Weight | 151.25 g/mol |
| Exact Mass | 151.14 |
| IUPAC Name | (2Z,4Z)-N,N-dimethylcycloocta-2,4-dien-1-amine |
| SMILES | CN(C)C1/C=C\C=C/CCC1 |
| InChI | InChI=1S/C10H17N/c1-11(2)10-8-6-4-3-5-7-9-10/h3-4,6,8,10H,5,7,9H2,1-2H3/b4-3-,8-6- |
| InChIKey | FWQLFABNQNBMML-XYMCEGRYSA-N |
| XLogP | 2.21 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.25 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |