C11H22O2S — CID 134994631
[(2R,3R,4S)-3-hexyl-4-methyl-1-oxothietan-2-yl]methanol (PubChem CID 134994631) has the molecular formula C11H22O2S and a molecular weight of 218.36 g/mol. Its IUPAC name is [(2R,3R,4S)-3-hexyl-4-methyl-1-oxothietan-2-yl]methanol.
| Compound Name | [(2R,3R,4S)-3-hexyl-4-methyl-1-oxothietan-2-yl]methanol |
|---|---|
| PubChem CID | 134994631 |
| Molecular Formula | C11H22O2S |
| Molecular Weight | 218.36 g/mol |
| Exact Mass | 218.13 |
| IUPAC Name | [(2R,3R,4S)-3-hexyl-4-methyl-1-oxothietan-2-yl]methanol |
| SMILES | CCCCCC[C@@H]1C(C)S(=O)[C@H]1CO |
| InChI | InChI=1S/C11H22O2S/c1-3-4-5-6-7-10-9(2)14(13)11(10)8-12/h9-12H,3-8H2,1-2H3/t9?,10-,11+,14?/m1/s1 |
| InChIKey | GNLRXDYQTTVNSF-PYUIQPRZSA-N |
| XLogP | 2.08 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.36 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|