About oct-1-yne;trichlorotitanium(1+)
oct-1-yne;trichlorotitanium(1+) (PubChem CID 134995198) has the molecular formula C8H13Cl3Ti
and a molecular weight of 263.42 g/mol. Its IUPAC name is oct-1-yne;trichlorotitanium(1+).
Molecular Properties
| Compound Name | oct-1-yne;trichlorotitanium(1+) |
| PubChem CID | 134995198 |
| Molecular Formula | C8H13Cl3Ti |
| Molecular Weight | 263.42 g/mol |
| Exact Mass | 261.96 |
| IUPAC Name | oct-1-yne;trichlorotitanium(1+) |
| SMILES | Cl[Ti+](Cl)Cl.[C-]#CCCCCCC |
| InChI | InChI=1S/C8H13.3ClH.Ti/c1-3-5-7-8-6-4-2;;;;/h3,5-8H2,1H3;3*1H;/q-1;;;;+4/p-3 |
| InChIKey | VZAGJGRZZJCQHJ-UHFFFAOYSA-K |
| XLogP | 4.61 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.42 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze oct-1-yne;trichlorotitanium(1+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of oct-1-yne;trichlorotitanium(1+)?
The IUPAC name of oct-1-yne;trichlorotitanium(1+) (CID 134995198) is oct-1-yne;trichlorotitanium(1+).
What is the SMILES notation for oct-1-yne;trichlorotitanium(1+)?
The canonical SMILES for oct-1-yne;trichlorotitanium(1+) is Cl[Ti+](Cl)Cl.[C-]#CCCCCCC.
What is the InChIKey of oct-1-yne;trichlorotitanium(1+)?
The InChIKey is VZAGJGRZZJCQHJ-UHFFFAOYSA-K. The full InChI is InChI=1S/C8H13.3ClH.Ti/c1-3-5-7-8-6-4-2;;;;/h3,5-8H2,1H3;3*1H;/q-1;;;;+4/p-3.
What are the key properties of oct-1-yne;trichlorotitanium(1+)?
oct-1-yne;trichlorotitanium(1+) has a molecular weight of 263.42 g/mol, XLogP of 4.61, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for oct-1-yne;trichlorotitanium(1+) is sourced from PubChem (CID 134995198), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).