C9H15NO5S — CID 134995666
methyl (4R,5S)-4-acetyl-5-hydroperoxy-2,2-dimethyl-1,3-thiazolidine-3-carboxylate (PubChem CID 134995666) has the molecular formula C9H15NO5S and a molecular weight of 249.29 g/mol. Its IUPAC name is methyl (4R,5S)-4-acetyl-5-hydroperoxy-2,2-dimethyl-1,3-thiazolidine-3-carboxylate.
| Compound Name | methyl (4R,5S)-4-acetyl-5-hydroperoxy-2,2-dimethyl-1,3-thiazolidine-3-carboxylate |
|---|---|
| PubChem CID | 134995666 |
| Molecular Formula | C9H15NO5S |
| Molecular Weight | 249.29 g/mol |
| Exact Mass | 249.07 |
| IUPAC Name | methyl (4R,5S)-4-acetyl-5-hydroperoxy-2,2-dimethyl-1,3-thiazolidine-3-carboxylate |
| SMILES | COC(=O)N1[C@H](C(C)=O)[C@@H](OO)SC1(C)C |
| InChI | InChI=1S/C9H15NO5S/c1-5(11)6-7(15-13)16-9(2,3)10(6)8(12)14-4/h6-7,13H,1-4H3/t6-,7+/m1/s1 |
| InChIKey | ZUYCVFNUTPRMFW-RQJHMYQMSA-N |
| XLogP | 1.31 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.29 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|