C6H13FO2 — CID 134995731
(2R,3S)-3-fluorohexane-1,2-diol (PubChem CID 134995731) has the molecular formula C6H13FO2 and a molecular weight of 136.17 g/mol. Its IUPAC name is (2R,3S)-3-fluorohexane-1,2-diol.
| Compound Name | (2R,3S)-3-fluorohexane-1,2-diol |
|---|---|
| PubChem CID | 134995731 |
| Molecular Formula | C6H13FO2 |
| Molecular Weight | 136.17 g/mol |
| Exact Mass | 136.09 |
| IUPAC Name | (2R,3S)-3-fluorohexane-1,2-diol |
| SMILES | CCC[C@H](F)[C@H](O)CO |
| InChI | InChI=1S/C6H13FO2/c1-2-3-5(7)6(9)4-8/h5-6,8-9H,2-4H2,1H3/t5-,6+/m0/s1 |
| InChIKey | XLBRFPJBQFDNCU-NTSWFWBYSA-N |
| XLogP | 0.48 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 136.17 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |