C14H24F3N — CID 134996573
1-[(E)-1,1,1-trifluoronon-2-en-2-yl]piperidine (PubChem CID 134996573) has the molecular formula C14H24F3N and a molecular weight of 263.35 g/mol. Its IUPAC name is 1-[(E)-1,1,1-trifluoronon-2-en-2-yl]piperidine.
| Compound Name | 1-[(E)-1,1,1-trifluoronon-2-en-2-yl]piperidine |
|---|---|
| PubChem CID | 134996573 |
| Molecular Formula | C14H24F3N |
| Molecular Weight | 263.35 g/mol |
| Exact Mass | 263.19 |
| IUPAC Name | 1-[(E)-1,1,1-trifluoronon-2-en-2-yl]piperidine |
| SMILES | CCCCCC/C=C(/N1CCCCC1)C(F)(F)F |
| InChI | InChI=1S/C14H24F3N/c1-2-3-4-5-7-10-13(14(15,16)17)18-11-8-6-9-12-18/h10H,2-9,11-12H2,1H3/b13-10+ |
| InChIKey | KVLORXVCLQHKBD-JLHYYAGUSA-N |
| XLogP | 4.89 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.35 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|