C7H12S — CID 134996658
(2S,3S)-2,3-dimethyl-3,4-dihydro-2H-thiopyran (PubChem CID 134996658) has the molecular formula C7H12S and a molecular weight of 128.24 g/mol. Its IUPAC name is (2S,3S)-2,3-dimethyl-3,4-dihydro-2H-thiopyran.
| Compound Name | (2S,3S)-2,3-dimethyl-3,4-dihydro-2H-thiopyran |
|---|---|
| PubChem CID | 134996658 |
| Molecular Formula | C7H12S |
| Molecular Weight | 128.24 g/mol |
| Exact Mass | 128.07 |
| IUPAC Name | (2S,3S)-2,3-dimethyl-3,4-dihydro-2H-thiopyran |
| SMILES | C[C@@H]1SC=CC[C@@H]1C |
| InChI | InChI=1S/C7H12S/c1-6-4-3-5-8-7(6)2/h3,5-7H,4H2,1-2H3/t6-,7-/m0/s1 |
| InChIKey | PWMDOTJWMXXMHU-BQBZGAKWSA-N |
| XLogP | 2.66 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 128.24 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |