C8H16S — CID 134980226
(4S,5S)-4-methyl-5-methylsulfanylhex-1-ene (PubChem CID 134980226) has the molecular formula C8H16S and a molecular weight of 144.28 g/mol. Its IUPAC name is (4S,5S)-4-methyl-5-methylsulfanylhex-1-ene.
| Compound Name | (4S,5S)-4-methyl-5-methylsulfanylhex-1-ene |
|---|---|
| PubChem CID | 134980226 |
| Molecular Formula | C8H16S |
| Molecular Weight | 144.28 g/mol |
| Exact Mass | 144.10 |
| IUPAC Name | (4S,5S)-4-methyl-5-methylsulfanylhex-1-ene |
| SMILES | C=CC[C@H](C)[C@H](C)SC |
| InChI | InChI=1S/C8H16S/c1-5-6-7(2)8(3)9-4/h5,7-8H,1,6H2,2-4H3/t7-,8-/m0/s1 |
| InChIKey | ZOPWMRBSRQEDGS-YUMQZZPRSA-N |
| XLogP | 2.95 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 144.28 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|