C17H12N4S2 — CID 134997325
(3,5-dithiophen-2-ylpyrazin-2-yl)-pyridin-1-ium-1-ylazanide (PubChem CID 134997325) has the molecular formula C17H12N4S2 and a molecular weight of 336.45 g/mol. Its IUPAC name is (3,5-dithiophen-2-ylpyrazin-2-yl)-pyridin-1-ium-1-ylazanide.
| Compound Name | (3,5-dithiophen-2-ylpyrazin-2-yl)-pyridin-1-ium-1-ylazanide |
|---|---|
| PubChem CID | 134997325 |
| Molecular Formula | C17H12N4S2 |
| Molecular Weight | 336.45 g/mol |
| Exact Mass | 336.05 |
| IUPAC Name | (3,5-dithiophen-2-ylpyrazin-2-yl)-pyridin-1-ium-1-ylazanide |
| SMILES | c1cc[n+]([N-]c2ncc(-c3cccs3)nc2-c2cccs2)cc1 |
| InChI | InChI=1S/C17H12N4S2/c1-2-8-21(9-3-1)20-17-16(15-7-5-11-23-15)19-13(12-18-17)14-6-4-10-22-14/h1-12H |
| InChIKey | ZSTFZVJENFCHDK-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 43.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.45 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|