C14H13N5S — CID 86000949
3-N-(pyridin-4-ylmethyl)-5-thiophen-3-ylpyrazine-2,3-diamine (PubChem CID 86000949) has the molecular formula C14H13N5S and a molecular weight of 283.36 g/mol. Its IUPAC name is 3-N-(pyridin-4-ylmethyl)-5-thiophen-3-ylpyrazine-2,3-diamine.
| Compound Name | 3-N-(pyridin-4-ylmethyl)-5-thiophen-3-ylpyrazine-2,3-diamine |
|---|---|
| PubChem CID | 86000949 |
| Molecular Formula | C14H13N5S |
| Molecular Weight | 283.36 g/mol |
| Exact Mass | 283.09 |
| IUPAC Name | 3-N-(pyridin-4-ylmethyl)-5-thiophen-3-ylpyrazine-2,3-diamine |
| SMILES | Nc1ncc(-c2ccsc2)nc1NCc1ccncc1 |
| InChI | InChI=1S/C14H13N5S/c15-13-14(18-7-10-1-4-16-5-2-10)19-12(8-17-13)11-3-6-20-9-11/h1-6,8-9H,7H2,(H2,15,17)(H,18,19) |
| InChIKey | CVBRPWWCPRZXKY-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 76.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.36 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |