C30H39NO6 — CID 134997423
tert-butyl 3-benzyl-4-oxo-4-[(4S)-2-oxo-4-propan-2-yl-1,3-oxazolidin-3-yl]-2-(2-phenylmethoxyethyl)butanoate (PubChem CID 134997423) has the molecular formula C30H39NO6 and a molecular weight of 509.64 g/mol. Its IUPAC name is tert-butyl 3-benzyl-4-oxo-4-[(4S)-2-oxo-4-propan-2-yl-1,3-oxazolidin-3-yl]-2-(2-phenylmethoxyethyl)butanoate.
| Compound Name | tert-butyl 3-benzyl-4-oxo-4-[(4S)-2-oxo-4-propan-2-yl-1,3-oxazolidin-3-yl]-2-(2-phenylmethoxyethyl)butanoate |
|---|---|
| PubChem CID | 134997423 |
| Molecular Formula | C30H39NO6 |
| Molecular Weight | 509.64 g/mol |
| Exact Mass | 509.28 |
| IUPAC Name | tert-butyl 3-benzyl-4-oxo-4-[(4S)-2-oxo-4-propan-2-yl-1,3-oxazolidin-3-yl]-2-(2-phenylmethoxyethyl)butanoate |
| SMILES | CC(C)[C@H]1COC(=O)N1C(=O)C(Cc1ccccc1)C(CCOCc1ccccc1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C30H39NO6/c1-21(2)26-20-36-29(34)31(26)27(32)25(18-22-12-8-6-9-13-22)24(28(33)37-30(3,4)5)16-17-35-19-23-14-10-7-11-15-23/h6-15,21,24-26H,16-20H2,1-5H3/t24?,25?,26-/m1/s1 |
| InChIKey | KXOALSQSKNIIFC-NRUKRLKBSA-N |
| XLogP | 5.41 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.64 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|