C38H43FO6Si — CID 134997443
[2-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-fluoro-4,5-bis(phenylmethoxy)oxan-3-yl] acetate (PubChem CID 134997443) has the molecular formula C38H43FO6Si and a molecular weight of 642.84 g/mol. Its IUPAC name is [2-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-fluoro-4,5-bis(phenylmethoxy)oxan-3-yl] acetate.
| Compound Name | [2-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-fluoro-4,5-bis(phenylmethoxy)oxan-3-yl] acetate |
|---|---|
| PubChem CID | 134997443 |
| Molecular Formula | C38H43FO6Si |
| Molecular Weight | 642.84 g/mol |
| Exact Mass | 642.28 |
| IUPAC Name | [2-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-fluoro-4,5-bis(phenylmethoxy)oxan-3-yl] acetate |
| SMILES | CC(=O)OC1C(CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)OC(F)C(OCc2ccccc2)C1OCc1ccccc1 |
| InChI | InChI=1S/C38H43FO6Si/c1-28(40)44-34-33(27-43-46(38(2,3)4,31-21-13-7-14-22-31)32-23-15-8-16-24-32)45-37(39)36(42-26-30-19-11-6-12-20-30)35(34)41-25-29-17-9-5-10-18-29/h5-24,33-37H,25-27H2,1-4H3 |
| InChIKey | YUDRVYVBKIXMTH-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.84 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|