C28H31NO3 — CID 134997457
ethyl (2S,3R)-1-benzhydryl-2-(1-hydroxybutyl)-3-phenylaziridine-2-carboxylate (PubChem CID 134997457) has the molecular formula C28H31NO3 and a molecular weight of 429.56 g/mol. Its IUPAC name is ethyl (2S,3R)-1-benzhydryl-2-(1-hydroxybutyl)-3-phenylaziridine-2-carboxylate.
| Compound Name | ethyl (2S,3R)-1-benzhydryl-2-(1-hydroxybutyl)-3-phenylaziridine-2-carboxylate |
|---|---|
| PubChem CID | 134997457 |
| Molecular Formula | C28H31NO3 |
| Molecular Weight | 429.56 g/mol |
| Exact Mass | 429.23 |
| IUPAC Name | ethyl (2S,3R)-1-benzhydryl-2-(1-hydroxybutyl)-3-phenylaziridine-2-carboxylate |
| SMILES | CCCC(O)[C@]1(C(=O)OCC)[C@@H](c2ccccc2)N1C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C28H31NO3/c1-3-14-24(30)28(27(31)32-4-2)26(23-19-12-7-13-20-23)29(28)25(21-15-8-5-9-16-21)22-17-10-6-11-18-22/h5-13,15-20,24-26,30H,3-4,14H2,1-2H3/t24?,26-,28-,29?/m1/s1 |
| InChIKey | BBZDGBIVUHZRHX-WUHMEECBSA-N |
| XLogP | 5.30 |
| TPSA | 49.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.56 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|