C28H41N3OSi — CID 134997894
[1-(benzotriazol-1-yl)-1-phenoxybut-3-enyl]-decyl-dimethylsilane (PubChem CID 134997894) has the molecular formula C28H41N3OSi and a molecular weight of 463.74 g/mol. Its IUPAC name is [1-(benzotriazol-1-yl)-1-phenoxybut-3-enyl]-decyl-dimethylsilane.
| Compound Name | [1-(benzotriazol-1-yl)-1-phenoxybut-3-enyl]-decyl-dimethylsilane |
|---|---|
| PubChem CID | 134997894 |
| Molecular Formula | C28H41N3OSi |
| Molecular Weight | 463.74 g/mol |
| Exact Mass | 463.30 |
| IUPAC Name | [1-(benzotriazol-1-yl)-1-phenoxybut-3-enyl]-decyl-dimethylsilane |
| SMILES | C=CCC(Oc1ccccc1)(n1nnc2ccccc21)[Si](C)(C)CCCCCCCCCC |
| InChI | InChI=1S/C28H41N3OSi/c1-5-7-8-9-10-11-12-18-24-33(3,4)28(23-6-2,32-25-19-14-13-15-20-25)31-27-22-17-16-21-26(27)29-30-31/h6,13-17,19-22H,2,5,7-12,18,23-24H2,1,3-4H3 |
| InChIKey | PNUSBFSIARGRBS-UHFFFAOYSA-N |
| XLogP | 8.13 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.74 |
| LogP ≤ 5 | 8.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|