C33H30Cl3N3 — CID 134998344
2,4,6-tris(3-chloro-5,6,7,8-tetrahydronaphthalen-2-yl)-1,3,5-triazine (PubChem CID 134998344) has the molecular formula C33H30Cl3N3 and a molecular weight of 574.98 g/mol. Its IUPAC name is 2,4,6-tris(3-chloro-5,6,7,8-tetrahydronaphthalen-2-yl)-1,3,5-triazine.
| Compound Name | 2,4,6-tris(3-chloro-5,6,7,8-tetrahydronaphthalen-2-yl)-1,3,5-triazine |
|---|---|
| PubChem CID | 134998344 |
| Molecular Formula | C33H30Cl3N3 |
| Molecular Weight | 574.98 g/mol |
| Exact Mass | 573.15 |
| IUPAC Name | 2,4,6-tris(3-chloro-5,6,7,8-tetrahydronaphthalen-2-yl)-1,3,5-triazine |
| SMILES | Clc1cc2c(cc1-c1nc(-c3cc4c(cc3Cl)CCCC4)nc(-c3cc4c(cc3Cl)CCCC4)n1)CCCC2 |
| InChI | InChI=1S/C33H30Cl3N3/c34-28-16-22-10-4-1-7-19(22)13-25(28)31-37-32(26-14-20-8-2-5-11-23(20)17-29(26)35)39-33(38-31)27-15-21-9-3-6-12-24(21)18-30(27)36/h13-18H,1-12H2 |
| InChIKey | BBPYQHINYKWSRJ-UHFFFAOYSA-N |
| XLogP | 9.47 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.98 |
| LogP ≤ 5 | 9.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |