C49H31N3 — CID 101520682
2,4-Bis(3-anthracen-9-ylphenyl)-6-phenyl-1,3,5-triazine (PubChem CID 101520682) has the molecular formula C49H31N3 and a molecular weight of 661.80 g/mol. Its IUPAC name is 2,4-bis(3-anthracen-9-ylphenyl)-6-phenyl-1,3,5-triazine.
| Compound Name | 2,4-Bis(3-anthracen-9-ylphenyl)-6-phenyl-1,3,5-triazine |
|---|---|
| PubChem CID | 101520682 |
| Molecular Formula | C49H31N3 |
| Molecular Weight | 661.80 g/mol |
| Exact Mass | 661.25 |
| IUPAC Name | 2,4-bis(3-anthracen-9-ylphenyl)-6-phenyl-1,3,5-triazine |
| SMILES | C1=CC=C(C=C1)C2=NC(=NC(=N2)C3=CC=CC(=C3)C4=C5C=CC=CC5=CC6=CC=CC=C64)C7=CC=CC(=C7)C8=C9C=CC=CC9=CC1=CC=CC=C18 |
| InChI | InChI=1S/C49H31N3/c1-2-14-32(15-3-1)47-50-48(39-22-12-20-37(30-39)45-41-24-8-4-16-33(41)28-34-17-5-9-25-42(34)45)52-49(51-47)40-23-13-21-38(31-40)46-43-26-10-6-18-35(43)29-36-19-7-11-27-44(36)46/h1-31H |
| InChIKey | IVEVSLGEQRUVPS-UHFFFAOYSA-N |
| XLogP | 13.20 |
| TPSA | 38.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 52 |
| Complexity | 1030 |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.80 |
| LogP ≤ 5 | 13.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|