C19H27NO2S — CID 134998517
N-(1-but-3-enyl-2-phenylcyclopent-2-en-1-yl)-2-methylpropane-2-sulfonamide (PubChem CID 134998517) has the molecular formula C19H27NO2S and a molecular weight of 333.50 g/mol. Its IUPAC name is N-(1-but-3-enyl-2-phenylcyclopent-2-en-1-yl)-2-methylpropane-2-sulfonamide.
| Compound Name | N-(1-but-3-enyl-2-phenylcyclopent-2-en-1-yl)-2-methylpropane-2-sulfonamide |
|---|---|
| PubChem CID | 134998517 |
| Molecular Formula | C19H27NO2S |
| Molecular Weight | 333.50 g/mol |
| Exact Mass | 333.18 |
| IUPAC Name | N-(1-but-3-enyl-2-phenylcyclopent-2-en-1-yl)-2-methylpropane-2-sulfonamide |
| SMILES | C=CCCC1(NS(=O)(=O)C(C)(C)C)CCC=C1c1ccccc1 |
| InChI | InChI=1S/C19H27NO2S/c1-5-6-14-19(20-23(21,22)18(2,3)4)15-10-13-17(19)16-11-8-7-9-12-16/h5,7-9,11-13,20H,1,6,10,14-15H2,2-4H3 |
| InChIKey | QYGWOKPNOKXJBA-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.50 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|