C22H40B2O4 — CID 135000382
2-[(Z,1R)-1-cyclohexyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)but-2-enyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 135000382) has the molecular formula C22H40B2O4 and a molecular weight of 390.18 g/mol. Its IUPAC name is 2-[(Z,1R)-1-cyclohexyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)but-2-enyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-[(Z,1R)-1-cyclohexyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)but-2-enyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 135000382 |
| Molecular Formula | C22H40B2O4 |
| Molecular Weight | 390.18 g/mol |
| Exact Mass | 390.31 |
| IUPAC Name | 2-[(Z,1R)-1-cyclohexyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)but-2-enyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | CC1(C)OB(C/C=C\[C@H](B2OC(C)(C)C(C)(C)O2)C2CCCCC2)OC1(C)C |
| InChI | InChI=1S/C22H40B2O4/c1-19(2)20(3,4)26-23(25-19)16-12-15-18(17-13-10-9-11-14-17)24-27-21(5,6)22(7,8)28-24/h12,15,17-18H,9-11,13-14,16H2,1-8H3/b15-12-/t18-/m0/s1 |
| InChIKey | KLHCSPCAWLIEPW-NZHZHZHDSA-N |
| XLogP | 5.68 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.18 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|