C23H42B2O4 — CID 134904626
2-[(Z)-1-cyclohexyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pent-1-en-2-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 134904626) has the molecular formula C23H42B2O4 and a molecular weight of 404.21 g/mol. Its IUPAC name is 2-[(Z)-1-cyclohexyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pent-1-en-2-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-[(Z)-1-cyclohexyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pent-1-en-2-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 134904626 |
| Molecular Formula | C23H42B2O4 |
| Molecular Weight | 404.21 g/mol |
| Exact Mass | 404.33 |
| IUPAC Name | 2-[(Z)-1-cyclohexyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pent-1-en-2-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | CCC/C(B1OC(C)(C)C(C)(C)O1)=C(/B1OC(C)(C)C(C)(C)O1)C1CCCCC1 |
| InChI | InChI=1S/C23H42B2O4/c1-10-14-18(24-26-20(2,3)21(4,5)27-24)19(17-15-12-11-13-16-17)25-28-22(6,7)23(8,9)29-25/h17H,10-16H2,1-9H3/b19-18- |
| InChIKey | CJYXCYSYFZKHAD-HNENSFHCSA-N |
| XLogP | 5.93 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.21 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|