C21H38B2O4 — CID 134904345
2-[1-cyclohexylidene-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 134904345) has the molecular formula C21H38B2O4 and a molecular weight of 376.16 g/mol. Its IUPAC name is 2-[1-cyclohexylidene-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-[1-cyclohexylidene-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 134904345 |
| Molecular Formula | C21H38B2O4 |
| Molecular Weight | 376.16 g/mol |
| Exact Mass | 376.30 |
| IUPAC Name | 2-[1-cyclohexylidene-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | CC1(C)OB(CCC(B2OC(C)(C)C(C)(C)O2)=C2CCCCC2)OC1(C)C |
| InChI | InChI=1S/C21H38B2O4/c1-18(2)19(3,4)25-22(24-18)15-14-17(16-12-10-9-11-13-16)23-26-20(5,6)21(7,8)27-23/h9-15H2,1-8H3 |
| InChIKey | PLZSYXURRFWCCF-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.16 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|