C14H21ClO4 — CID 135001432
dimethyl (E,4E)-4-(1-chloroheptylidene)pent-2-enedioate (PubChem CID 135001432) has the molecular formula C14H21ClO4 and a molecular weight of 288.77 g/mol. Its IUPAC name is dimethyl (E,4E)-4-(1-chloroheptylidene)pent-2-enedioate.
| Compound Name | dimethyl (E,4E)-4-(1-chloroheptylidene)pent-2-enedioate |
|---|---|
| PubChem CID | 135001432 |
| Molecular Formula | C14H21ClO4 |
| Molecular Weight | 288.77 g/mol |
| Exact Mass | 288.11 |
| IUPAC Name | dimethyl (E,4E)-4-(1-chloroheptylidene)pent-2-enedioate |
| SMILES | CCCCCC/C(Cl)=C(/C=C/C(=O)OC)C(=O)OC |
| InChI | InChI=1S/C14H21ClO4/c1-4-5-6-7-8-12(15)11(14(17)19-3)9-10-13(16)18-2/h9-10H,4-8H2,1-3H3/b10-9+,12-11+ |
| InChIKey | IXNAJRMLFQPXSU-HULFFUFUSA-N |
| XLogP | 3.35 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.77 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|