C15H23ClO4 — CID 135001673
1-O-ethyl 5-O-methyl (E,4E)-4-(1-chloroheptylidene)pent-2-enedioate (PubChem CID 135001673) has the molecular formula C15H23ClO4 and a molecular weight of 302.80 g/mol. Its IUPAC name is 1-O-ethyl 5-O-methyl (E,4E)-4-(1-chloroheptylidene)pent-2-enedioate.
| Compound Name | 1-O-ethyl 5-O-methyl (E,4E)-4-(1-chloroheptylidene)pent-2-enedioate |
|---|---|
| PubChem CID | 135001673 |
| Molecular Formula | C15H23ClO4 |
| Molecular Weight | 302.80 g/mol |
| Exact Mass | 302.13 |
| IUPAC Name | 1-O-ethyl 5-O-methyl (E,4E)-4-(1-chloroheptylidene)pent-2-enedioate |
| SMILES | CCCCCC/C(Cl)=C(/C=C/C(=O)OCC)C(=O)OC |
| InChI | InChI=1S/C15H23ClO4/c1-4-6-7-8-9-13(16)12(15(18)19-3)10-11-14(17)20-5-2/h10-11H,4-9H2,1-3H3/b11-10+,13-12+ |
| InChIKey | DLYCWNBDPNUHOE-AQASXUMVSA-N |
| XLogP | 3.74 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.80 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|