C23H32BrNO2 — CID 135002082
1-(2-bromophenyl)-4-(oxan-2-yloxy)-N-(2,4,4-trimethylpentan-2-yl)but-2-yn-1-imine (PubChem CID 135002082) has the molecular formula C23H32BrNO2 and a molecular weight of 434.42 g/mol. Its IUPAC name is 1-(2-bromophenyl)-4-(oxan-2-yloxy)-N-(2,4,4-trimethylpentan-2-yl)but-2-yn-1-imine.
| Compound Name | 1-(2-bromophenyl)-4-(oxan-2-yloxy)-N-(2,4,4-trimethylpentan-2-yl)but-2-yn-1-imine |
|---|---|
| PubChem CID | 135002082 |
| Molecular Formula | C23H32BrNO2 |
| Molecular Weight | 434.42 g/mol |
| Exact Mass | 433.16 |
| IUPAC Name | 1-(2-bromophenyl)-4-(oxan-2-yloxy)-N-(2,4,4-trimethylpentan-2-yl)but-2-yn-1-imine |
| SMILES | CC(C)(C)CC(C)(C)/N=C(\C#CCOC1CCCCO1)c1ccccc1Br |
| InChI | InChI=1S/C23H32BrNO2/c1-22(2,3)17-23(4,5)25-20(18-11-6-7-12-19(18)24)13-10-16-27-21-14-8-9-15-26-21/h6-7,11-12,21H,8-9,14-17H2,1-5H3/b25-20+ |
| InChIKey | QAKDMULNYAYSBG-LKUDQCMESA-N |
| XLogP | 6.00 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.42 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|