C19H26BrNO — CID 135002083
1-(2-bromophenyl)-4-methoxy-N-(2,4,4-trimethylpentan-2-yl)but-2-yn-1-imine (PubChem CID 135002083) has the molecular formula C19H26BrNO and a molecular weight of 364.33 g/mol. Its IUPAC name is 1-(2-bromophenyl)-4-methoxy-N-(2,4,4-trimethylpentan-2-yl)but-2-yn-1-imine.
| Compound Name | 1-(2-bromophenyl)-4-methoxy-N-(2,4,4-trimethylpentan-2-yl)but-2-yn-1-imine |
|---|---|
| PubChem CID | 135002083 |
| Molecular Formula | C19H26BrNO |
| Molecular Weight | 364.33 g/mol |
| Exact Mass | 363.12 |
| IUPAC Name | 1-(2-bromophenyl)-4-methoxy-N-(2,4,4-trimethylpentan-2-yl)but-2-yn-1-imine |
| SMILES | COCC#C/C(=N\C(C)(C)CC(C)(C)C)c1ccccc1Br |
| InChI | InChI=1S/C19H26BrNO/c1-18(2,3)14-19(4,5)21-17(12-9-13-22-6)15-10-7-8-11-16(15)20/h7-8,10-11H,13-14H2,1-6H3/b21-17+ |
| InChIKey | JYVRUBNQZJQHSA-HEHNFIMWSA-N |
| XLogP | 5.10 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.33 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|