C26H30BrN — CID 135002303
1-(6-bromo-2,3-dihydro-1H-inden-5-yl)-3-phenyl-N-(2,4,4-trimethylpentan-2-yl)prop-2-yn-1-imine (PubChem CID 135002303) has the molecular formula C26H30BrN and a molecular weight of 436.44 g/mol. Its IUPAC name is 1-(6-bromo-2,3-dihydro-1H-inden-5-yl)-3-phenyl-N-(2,4,4-trimethylpentan-2-yl)prop-2-yn-1-imine.
| Compound Name | 1-(6-bromo-2,3-dihydro-1H-inden-5-yl)-3-phenyl-N-(2,4,4-trimethylpentan-2-yl)prop-2-yn-1-imine |
|---|---|
| PubChem CID | 135002303 |
| Molecular Formula | C26H30BrN |
| Molecular Weight | 436.44 g/mol |
| Exact Mass | 435.16 |
| IUPAC Name | 1-(6-bromo-2,3-dihydro-1H-inden-5-yl)-3-phenyl-N-(2,4,4-trimethylpentan-2-yl)prop-2-yn-1-imine |
| SMILES | CC(C)(C)CC(C)(C)/N=C(\C#Cc1ccccc1)c1cc2c(cc1Br)CCC2 |
| InChI | InChI=1S/C26H30BrN/c1-25(2,3)18-26(4,5)28-24(15-14-19-10-7-6-8-11-19)22-16-20-12-9-13-21(20)17-23(22)27/h6-8,10-11,16-17H,9,12-13,18H2,1-5H3/b28-24+ |
| InChIKey | WZAAHYYVHAKNJO-ZZIIXHQDSA-N |
| XLogP | 6.99 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.44 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|