C27H32BrN — CID 135002310
1-(3-bromo-5,6,7,8-tetrahydronaphthalen-2-yl)-3-phenyl-N-(2,4,4-trimethylpentan-2-yl)prop-2-yn-1-imine (PubChem CID 135002310) has the molecular formula C27H32BrN and a molecular weight of 450.46 g/mol. Its IUPAC name is 1-(3-bromo-5,6,7,8-tetrahydronaphthalen-2-yl)-3-phenyl-N-(2,4,4-trimethylpentan-2-yl)prop-2-yn-1-imine.
| Compound Name | 1-(3-bromo-5,6,7,8-tetrahydronaphthalen-2-yl)-3-phenyl-N-(2,4,4-trimethylpentan-2-yl)prop-2-yn-1-imine |
|---|---|
| PubChem CID | 135002310 |
| Molecular Formula | C27H32BrN |
| Molecular Weight | 450.46 g/mol |
| Exact Mass | 449.17 |
| IUPAC Name | 1-(3-bromo-5,6,7,8-tetrahydronaphthalen-2-yl)-3-phenyl-N-(2,4,4-trimethylpentan-2-yl)prop-2-yn-1-imine |
| SMILES | CC(C)(C)CC(C)(C)/N=C(\C#Cc1ccccc1)c1cc2c(cc1Br)CCCC2 |
| InChI | InChI=1S/C27H32BrN/c1-26(2,3)19-27(4,5)29-25(16-15-20-11-7-6-8-12-20)23-17-21-13-9-10-14-22(21)18-24(23)28/h6-8,11-12,17-18H,9-10,13-14,19H2,1-5H3/b29-25+ |
| InChIKey | QAWFQZHWJBUSHC-XLVZBRSZSA-N |
| XLogP | 7.38 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.46 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|