C23H21NO2 — CID 135003476
(3R,7R,9R,10R)-9-methoxy-10-phenyl-6-oxa-11-azapentacyclo[9.6.1.02,8.03,7.014,18]octadeca-1(17),2(8),12,14(18),15-pentaene (PubChem CID 135003476) has the molecular formula C23H21NO2 and a molecular weight of 343.43 g/mol. Its IUPAC name is (3R,7R,9R,10R)-9-methoxy-10-phenyl-6-oxa-11-azapentacyclo[9.6.1.02,8.03,7.014,18]octadeca-1(17),2(8),12,14(18),15-pentaene.
| Compound Name | (3R,7R,9R,10R)-9-methoxy-10-phenyl-6-oxa-11-azapentacyclo[9.6.1.02,8.03,7.014,18]octadeca-1(17),2(8),12,14(18),15-pentaene |
|---|---|
| PubChem CID | 135003476 |
| Molecular Formula | C23H21NO2 |
| Molecular Weight | 343.43 g/mol |
| Exact Mass | 343.16 |
| IUPAC Name | (3R,7R,9R,10R)-9-methoxy-10-phenyl-6-oxa-11-azapentacyclo[9.6.1.02,8.03,7.014,18]octadeca-1(17),2(8),12,14(18),15-pentaene |
| SMILES | CO[C@@H]1C2=C(c3cccc4ccn(c34)[C@@H]1c1ccccc1)[C@H]1CCO[C@@H]21 |
| InChI | InChI=1S/C23H21NO2/c1-25-23-19-18(17-11-13-26-22(17)19)16-9-5-8-15-10-12-24(20(15)16)21(23)14-6-3-2-4-7-14/h2-10,12,17,21-23H,11,13H2,1H3/t17-,21-,22-,23-/m1/s1 |
| InChIKey | TXLYQZGYDGJPIG-ULLYJBBUSA-N |
| XLogP | 4.43 |
| TPSA | 23.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.43 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |