C15H11F2NO5S — CID 135004075
[2,2-difluoro-1-(4-nitrophenyl)ethenyl] 4-methylbenzenesulfonate (PubChem CID 135004075) has the molecular formula C15H11F2NO5S and a molecular weight of 355.32 g/mol. Its IUPAC name is [2,2-difluoro-1-(4-nitrophenyl)ethenyl] 4-methylbenzenesulfonate.
| Compound Name | [2,2-difluoro-1-(4-nitrophenyl)ethenyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 135004075 |
| Molecular Formula | C15H11F2NO5S |
| Molecular Weight | 355.32 g/mol |
| Exact Mass | 355.03 |
| IUPAC Name | [2,2-difluoro-1-(4-nitrophenyl)ethenyl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OC(=C(F)F)c2ccc([N+](=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C15H11F2NO5S/c1-10-2-8-13(9-3-10)24(21,22)23-14(15(16)17)11-4-6-12(7-5-11)18(19)20/h2-9H,1H3 |
| InChIKey | ROCDZXCCRBIZCA-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 86.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.32 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|