C15H12F3NO5S — CID 52942398
1,1,1-trifluoro-2-[4-(4-nitrophenyl)sulfonylphenyl]propan-2-ol (PubChem CID 52942398) has the molecular formula C15H12F3NO5S and a molecular weight of 375.32 g/mol. Its IUPAC name is 1,1,1-trifluoro-2-[4-(4-nitrophenyl)sulfonylphenyl]propan-2-ol.
| Compound Name | 1,1,1-trifluoro-2-[4-(4-nitrophenyl)sulfonylphenyl]propan-2-ol |
|---|---|
| PubChem CID | 52942398 |
| Molecular Formula | C15H12F3NO5S |
| Molecular Weight | 375.32 g/mol |
| Exact Mass | 375.04 |
| IUPAC Name | 1,1,1-trifluoro-2-[4-(4-nitrophenyl)sulfonylphenyl]propan-2-ol |
| SMILES | CC(O)(c1ccc(S(=O)(=O)c2ccc([N+](=O)[O-])cc2)cc1)C(F)(F)F |
| InChI | InChI=1S/C15H12F3NO5S/c1-14(20,15(16,17)18)10-2-6-12(7-3-10)25(23,24)13-8-4-11(5-9-13)19(21)22/h2-9,20H,1H3 |
| InChIKey | AZFKXBDELQNCEH-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 97.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.32 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|