C15H11F3O3S — CID 135004078
[2,2-Difluoro-1-(3-fluorophenyl)ethenyl] 4-methylbenzenesulfonate (PubChem CID 135004078) has the molecular formula C15H11F3O3S and a molecular weight of 328.30 g/mol. Its IUPAC name is [2,2-difluoro-1-(3-fluorophenyl)ethenyl] 4-methylbenzenesulfonate.
| Compound Name | [2,2-Difluoro-1-(3-fluorophenyl)ethenyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 135004078 |
| Molecular Formula | C15H11F3O3S |
| Molecular Weight | 328.30 g/mol |
| Exact Mass | 328.04 |
| IUPAC Name | [2,2-difluoro-1-(3-fluorophenyl)ethenyl] 4-methylbenzenesulfonate |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)OC(=C(F)F)C2=CC(=CC=C2)F |
| InChI | InChI=1S/C15H11F3O3S/c1-10-5-7-13(8-6-10)22(19,20)21-14(15(17)18)11-3-2-4-12(16)9-11/h2-9H,1H3 |
| InChIKey | UBLJXFIQRSMTGU-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 51.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | 501 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.30 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|