C12H9Cl4NO3S — CID 135004453
1-methoxy-4-[[(1Z)-1,3,4,4-tetrachloro-2-nitrobuta-1,3-dienyl]sulfanylmethyl]benzene (PubChem CID 135004453) has the molecular formula C12H9Cl4NO3S and a molecular weight of 389.09 g/mol. Its IUPAC name is 1-methoxy-4-[[(1Z)-1,3,4,4-tetrachloro-2-nitrobuta-1,3-dienyl]sulfanylmethyl]benzene.
| Compound Name | 1-methoxy-4-[[(1Z)-1,3,4,4-tetrachloro-2-nitrobuta-1,3-dienyl]sulfanylmethyl]benzene |
|---|---|
| PubChem CID | 135004453 |
| Molecular Formula | C12H9Cl4NO3S |
| Molecular Weight | 389.09 g/mol |
| Exact Mass | 386.91 |
| IUPAC Name | 1-methoxy-4-[[(1Z)-1,3,4,4-tetrachloro-2-nitrobuta-1,3-dienyl]sulfanylmethyl]benzene |
| SMILES | COc1ccc(CS/C(Cl)=C(\C(Cl)=C(Cl)Cl)[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C12H9Cl4NO3S/c1-20-8-4-2-7(3-5-8)6-21-12(16)10(17(18)19)9(13)11(14)15/h2-5H,6H2,1H3/b12-10+ |
| InChIKey | ZYUIALGZYPZDLN-ZRDIBKRKSA-N |
| XLogP | 5.50 |
| TPSA | 52.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.09 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|