C14H19NO2S3 — CID 135004493
(4R)-4-butyl-3-(4-methylphenyl)sulfonyl-1,3-thiazolidine-2-thione (PubChem CID 135004493) has the molecular formula C14H19NO2S3 and a molecular weight of 329.51 g/mol. Its IUPAC name is (4R)-4-butyl-3-(4-methylphenyl)sulfonyl-1,3-thiazolidine-2-thione.
| Compound Name | (4R)-4-butyl-3-(4-methylphenyl)sulfonyl-1,3-thiazolidine-2-thione |
|---|---|
| PubChem CID | 135004493 |
| Molecular Formula | C14H19NO2S3 |
| Molecular Weight | 329.51 g/mol |
| Exact Mass | 329.06 |
| IUPAC Name | (4R)-4-butyl-3-(4-methylphenyl)sulfonyl-1,3-thiazolidine-2-thione |
| SMILES | CCCC[C@@H]1CSC(=S)N1S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C14H19NO2S3/c1-3-4-5-12-10-19-14(18)15(12)20(16,17)13-8-6-11(2)7-9-13/h6-9,12H,3-5,10H2,1-2H3/t12-/m1/s1 |
| InChIKey | MJFZRTGEOLPTIZ-GFCCVEGCSA-N |
| XLogP | 3.58 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.51 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|