C11H9NO2 — CID 135005027
6-methyl-3-phenyl-1,4-oxazin-2-one (PubChem CID 135005027) has the molecular formula C11H9NO2 and a molecular weight of 187.20 g/mol. Its IUPAC name is 6-methyl-3-phenyl-1,4-oxazin-2-one.
| Compound Name | 6-methyl-3-phenyl-1,4-oxazin-2-one |
|---|---|
| PubChem CID | 135005027 |
| Molecular Formula | C11H9NO2 |
| Molecular Weight | 187.20 g/mol |
| Exact Mass | 187.06 |
| IUPAC Name | 6-methyl-3-phenyl-1,4-oxazin-2-one |
| SMILES | Cc1cnc(-c2ccccc2)c(=O)o1 |
| InChI | InChI=1S/C11H9NO2/c1-8-7-12-10(11(13)14-8)9-5-3-2-4-6-9/h2-7H,1H3 |
| InChIKey | HLLBUSXASUWHDP-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 43.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.20 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |