C23H25ClN2 — CID 1350055
(5R)-6-[(4-chlorophenyl)methyl]-14-methyl-6,10-diazatetracyclo[8.6.1.05,17.011,16]heptadeca-1(17),11(16),12,14-tetraene (PubChem CID 1350055) has the molecular formula C23H25ClN2 and a molecular weight of 364.92 g/mol. Its IUPAC name is (5R)-6-[(4-chlorophenyl)methyl]-14-methyl-6,10-diazatetracyclo[8.6.1.05,17.011,16]heptadeca-1(17),11(16),12,14-tetraene.
| Compound Name | (5R)-6-[(4-chlorophenyl)methyl]-14-methyl-6,10-diazatetracyclo[8.6.1.05,17.011,16]heptadeca-1(17),11(16),12,14-tetraene |
|---|---|
| PubChem CID | 1350055 |
| Molecular Formula | C23H25ClN2 |
| Molecular Weight | 364.92 g/mol |
| Exact Mass | 364.17 |
| IUPAC Name | (5R)-6-[(4-chlorophenyl)methyl]-14-methyl-6,10-diazatetracyclo[8.6.1.05,17.011,16]heptadeca-1(17),11(16),12,14-tetraene |
| SMILES | Cc1ccc2c(c1)c1c3n2CCCN(Cc2ccc(Cl)cc2)[C@@H]3CCC1 |
| InChI | InChI=1S/C23H25ClN2/c1-16-6-11-21-20(14-16)19-4-2-5-22-23(19)26(21)13-3-12-25(22)15-17-7-9-18(24)10-8-17/h6-11,14,22H,2-5,12-13,15H2,1H3/t22-/m1/s1 |
| InChIKey | IMQOEWZJPQHDGX-JOCHJYFZSA-N |
| XLogP | 5.89 |
| TPSA | 8.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.92 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|