C25H21NO3 — CID 135006360
N-[(3S,4R)-3-methyl-2-oxo-4,6-diphenyl-4H-pyran-3-yl]benzamide (PubChem CID 135006360) has the molecular formula C25H21NO3 and a molecular weight of 383.45 g/mol. Its IUPAC name is N-[(3S,4R)-3-methyl-2-oxo-4,6-diphenyl-4H-pyran-3-yl]benzamide.
| Compound Name | N-[(3S,4R)-3-methyl-2-oxo-4,6-diphenyl-4H-pyran-3-yl]benzamide |
|---|---|
| PubChem CID | 135006360 |
| Molecular Formula | C25H21NO3 |
| Molecular Weight | 383.45 g/mol |
| Exact Mass | 383.15 |
| IUPAC Name | N-[(3S,4R)-3-methyl-2-oxo-4,6-diphenyl-4H-pyran-3-yl]benzamide |
| SMILES | C[C@@]1(NC(=O)c2ccccc2)C(=O)OC(c2ccccc2)=C[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C25H21NO3/c1-25(26-23(27)20-15-9-4-10-16-20)21(18-11-5-2-6-12-18)17-22(29-24(25)28)19-13-7-3-8-14-19/h2-17,21H,1H3,(H,26,27)/t21-,25+/m1/s1 |
| InChIKey | KTFTTZFITUTGKU-BWKNWUBXSA-N |
| XLogP | 4.56 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.45 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |