C18H28O6 — CID 135006376
dimethyl (3S)-3-[(2S)-5-(2-hydroxypropan-2-yl)-2-methyloxolan-2-yl]-4-methylidenecyclopentane-1,1-dicarboxylate (PubChem CID 135006376) has the molecular formula C18H28O6 and a molecular weight of 340.42 g/mol. Its IUPAC name is dimethyl (3S)-3-[(2S)-5-(2-hydroxypropan-2-yl)-2-methyloxolan-2-yl]-4-methylidenecyclopentane-1,1-dicarboxylate.
| Compound Name | dimethyl (3S)-3-[(2S)-5-(2-hydroxypropan-2-yl)-2-methyloxolan-2-yl]-4-methylidenecyclopentane-1,1-dicarboxylate |
|---|---|
| PubChem CID | 135006376 |
| Molecular Formula | C18H28O6 |
| Molecular Weight | 340.42 g/mol |
| Exact Mass | 340.19 |
| IUPAC Name | dimethyl (3S)-3-[(2S)-5-(2-hydroxypropan-2-yl)-2-methyloxolan-2-yl]-4-methylidenecyclopentane-1,1-dicarboxylate |
| SMILES | C=C1CC(C(=O)OC)(C(=O)OC)C[C@@H]1[C@]1(C)CCC(C(C)(C)O)O1 |
| InChI | InChI=1S/C18H28O6/c1-11-9-18(14(19)22-5,15(20)23-6)10-12(11)17(4)8-7-13(24-17)16(2,3)21/h12-13,21H,1,7-10H2,2-6H3/t12-,13?,17-/m0/s1 |
| InChIKey | GMCBMXBTCHNWRV-NKGYKZILSA-N |
| XLogP | 1.99 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.42 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|