C6H9Cl3O — CID 135006652
(2R,3S)-1,1,1-trichloro-3-methylpent-4-en-2-ol (PubChem CID 135006652) has the molecular formula C6H9Cl3O and a molecular weight of 203.50 g/mol. Its IUPAC name is (2R,3S)-1,1,1-trichloro-3-methylpent-4-en-2-ol.
| Compound Name | (2R,3S)-1,1,1-trichloro-3-methylpent-4-en-2-ol |
|---|---|
| PubChem CID | 135006652 |
| Molecular Formula | C6H9Cl3O |
| Molecular Weight | 203.50 g/mol |
| Exact Mass | 201.97 |
| IUPAC Name | (2R,3S)-1,1,1-trichloro-3-methylpent-4-en-2-ol |
| SMILES | C=C[C@H](C)[C@@H](O)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C6H9Cl3O/c1-3-4(2)5(10)6(7,8)9/h3-5,10H,1H2,2H3/t4-,5+/m0/s1 |
| InChIKey | BPDCSDXBCDGZPH-CRCLSJGQSA-N |
| XLogP | 2.54 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.50 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|